|
 |
| |
 3-Chlorobenzophenone |
Alias |
(3-Chlorophenyl)phenylketone; 3-Benzoylchlorobenzene; (3-chlorophenyl)(phenyl)methanone |
CAS NO. |
1016-78-0 |
EINECS NO. |
213-809-0 |
Molecular formula |
C13H9ClO |
Molecular weight |
216.663 |
Structural formula |
|
InChI |
InChI=1/C13H9ClO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9H |
Density |
1.207g/cm3 |
Melting |
82-85¡æ |
Boiling point |
339.1°C at 760 mmHg |
Flash point |
178.3°C |
Vapor Pressure |
9.39E-05mmHg at 25°C |
Risk Phrases |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.
R36/37/38:Irritating to eyes, respiratory system and skin. |
Security terms |
S22:Do not breathe dust.
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection. |
Usage |
Used as pharmaceutical intermediates |
|
|
|
|
|
